C14H19F2NO2S — CID 63821978
4-(difluoromethylsulfonyl)-N-[(1-methylcyclopentyl)methyl]aniline (PubChem CID 63821978) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(1-methylcyclopentyl)methyl]aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(1-methylcyclopentyl)methyl]aniline |
|---|---|
| PubChem CID | 63821978 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(1-methylcyclopentyl)methyl]aniline |
| SMILES | CC1(CNc2ccc(S(=O)(=O)C(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-14(8-2-3-9-14)10-17-11-4-6-12(7-5-11)20(18,19)13(15)16/h4-7,13,17H,2-3,8-10H2,1H3 |
| InChIKey | KUGMWJSXSFUQJQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |