C14H19F2NO3S — CID 65110379
1-[[4-(difluoromethylsulfonyl)anilino]methyl]cyclohexan-1-ol (PubChem CID 65110379) has the molecular formula C14H19F2NO3S and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfonyl)anilino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[4-(difluoromethylsulfonyl)anilino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65110379 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[[4-(difluoromethylsulfonyl)anilino]methyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(c1ccc(NCC2(O)CCCCC2)cc1)C(F)F |
| InChI | InChI=1S/C14H19F2NO3S/c15-13(16)21(19,20)12-6-4-11(5-7-12)17-10-14(18)8-2-1-3-9-14/h4-7,13,17-18H,1-3,8-10H2 |
| InChIKey | OQPYBWXZUDBCSV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |