C19H18F2N2O4S — CID 78827274
3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 78827274) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78827274 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)N(Cc3ccc(S(=O)(=O)C(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H18F2N2O4S/c1-12-3-7-14(8-4-12)19(2)16(24)23(18(25)22-19)11-13-5-9-15(10-6-13)28(26,27)17(20)21/h3-10,17H,11H2,1-2H3,(H,22,25) |
| InChIKey | IYUPAQYRISWACP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|