C15H16F2N2O4S — CID 78827283
5-cyclopropyl-3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 78827283) has the molecular formula C15H16F2N2O4S and a molecular weight of 358.37 g/mol. Its IUPAC name is 5-cyclopropyl-3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78827283 |
| Molecular Formula | C15H16F2N2O4S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-cyclopropyl-3-[[4-(difluoromethylsulfonyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C2CC2)NC(=O)N(Cc2ccc(S(=O)(=O)C(F)F)cc2)C1=O |
| InChI | InChI=1S/C15H16F2N2O4S/c1-15(10-4-5-10)12(20)19(14(21)18-15)8-9-2-6-11(7-3-9)24(22,23)13(16)17/h2-3,6-7,10,13H,4-5,8H2,1H3,(H,18,21) |
| InChIKey | GUORBWLZGLPXAB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|