C16H17F2N3O5S — CID 55360371
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 55360371) has the molecular formula C16H17F2N3O5S and a molecular weight of 401.39 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55360371 |
| Molecular Formula | C16H17F2N3O5S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)Nc2ccccc2S(=O)(=O)C(F)F)C1=O |
| InChI | InChI=1S/C16H17F2N3O5S/c1-16(9-6-7-9)13(23)21(15(24)20-16)8-12(22)19-10-4-2-3-5-11(10)27(25,26)14(17)18/h2-5,9,14H,6-8H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | ABYNCDOCIZHTGO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|