C18H24N4O3 — CID 119438955
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(ethylaminomethyl)phenyl]acetamide (PubChem CID 119438955) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(ethylaminomethyl)phenyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(ethylaminomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 119438955 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(ethylaminomethyl)phenyl]acetamide |
| SMILES | CCNCc1ccccc1NC(=O)CN1C(=O)NC(C)(C2CC2)C1=O |
| InChI | InChI=1S/C18H24N4O3/c1-3-19-10-12-6-4-5-7-14(12)20-15(23)11-22-16(24)18(2,13-8-9-13)21-17(22)25/h4-7,13,19H,3,8-11H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | IGJJFDVFVVXZEH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|