C17H19F2N3O4 — CID 18143899
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 18143899) has the molecular formula C17H19F2N3O4 and a molecular weight of 367.35 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 18143899 |
| Molecular Formula | C17H19F2N3O4 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)NCc2ccccc2OC(F)F)C1=O |
| InChI | InChI=1S/C17H19F2N3O4/c1-17(11-6-7-11)14(24)22(16(25)21-17)9-13(23)20-8-10-4-2-3-5-12(10)26-15(18)19/h2-5,11,15H,6-9H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | KLRKEPXXXSWODX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|