C8H9Cl2NO2S — CID 50876498
2,4-dichloro-N,3-dimethylbenzenesulfonamide (PubChem CID 50876498) has the molecular formula C8H9Cl2NO2S and a molecular weight of 254.14 g/mol. Its IUPAC name is 2,4-dichloro-N,3-dimethylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 50876498 |
| Molecular Formula | C8H9Cl2NO2S |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 2,4-dichloro-N,3-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C)c1Cl |
| InChI | InChI=1S/C8H9Cl2NO2S/c1-5-6(9)3-4-7(8(5)10)14(12,13)11-2/h3-4,11H,1-2H3 |
| InChIKey | ORAPTNDIBNXKGL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |