About 2,4-dichloro-N,3-dimethylbenzenesulfonamide
2,4-dichloro-N,3-dimethylbenzenesulfonamide (PubChem CID 50876498) has the molecular formula C8H9Cl2NO2S
and a molecular weight of 254.14 g/mol. Its IUPAC name is 2,4-dichloro-N,3-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2,4-dichloro-N,3-dimethylbenzenesulfonamide |
| PubChem CID | 50876498 |
| Molecular Formula | C8H9Cl2NO2S |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 2,4-dichloro-N,3-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C)c1Cl |
| InChI | InChI=1S/C8H9Cl2NO2S/c1-5-6(9)3-4-7(8(5)10)14(12,13)11-2/h3-4,11H,1-2H3 |
| InChIKey | ORAPTNDIBNXKGL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-N,3-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-N,3-dimethylbenzenesulfonamide?
The IUPAC name of 2,4-dichloro-N,3-dimethylbenzenesulfonamide (CID 50876498) is 2,4-dichloro-N,3-dimethylbenzenesulfonamide.
What is the SMILES notation for 2,4-dichloro-N,3-dimethylbenzenesulfonamide?
The canonical SMILES for 2,4-dichloro-N,3-dimethylbenzenesulfonamide is CNS(=O)(=O)c1ccc(Cl)c(C)c1Cl.
What is the InChIKey of 2,4-dichloro-N,3-dimethylbenzenesulfonamide?
The InChIKey is ORAPTNDIBNXKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2NO2S/c1-5-6(9)3-4-7(8(5)10)14(12,13)11-2/h3-4,11H,1-2H3.
What are the key properties of 2,4-dichloro-N,3-dimethylbenzenesulfonamide?
2,4-dichloro-N,3-dimethylbenzenesulfonamide has a molecular weight of 254.14 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-N,3-dimethylbenzenesulfonamide is sourced from PubChem (CID 50876498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).