C19H21ClN6O2S — CID 1435642
1-[(4-chlorophenyl)methyl]-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine (PubChem CID 1435642) has the molecular formula C19H21ClN6O2S and a molecular weight of 432.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 1435642 |
| Molecular Formula | C19H21ClN6O2S |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C19H21ClN6O2S/c1-15-12-18(6-7-19(15)26-14-21-22-23-26)29(27,28)25-10-8-24(9-11-25)13-16-2-4-17(20)5-3-16/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | RNHBFHJKYLEBKM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |