C14H20N6O3S — CID 46262720
N,N-dimethyl-4-[4-(tetrazol-1-yl)phenoxy]piperidine-1-sulfonamide (PubChem CID 46262720) has the molecular formula C14H20N6O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(tetrazol-1-yl)phenoxy]piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-[4-(tetrazol-1-yl)phenoxy]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 46262720 |
| Molecular Formula | C14H20N6O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N,N-dimethyl-4-[4-(tetrazol-1-yl)phenoxy]piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(Oc2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C14H20N6O3S/c1-18(2)24(21,22)19-9-7-14(8-10-19)23-13-5-3-12(4-6-13)20-11-15-16-17-20/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | YQICDULDFFJTCQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |