C19H29N3O5S — CID 42393600
3-[1-(dimethylsulfamoyl)piperidin-4-yl]oxy-N-methyl-N-[(3R)-oxolan-3-yl]benzamide (PubChem CID 42393600) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 3-[1-(dimethylsulfamoyl)piperidin-4-yl]oxy-N-methyl-N-[(3R)-oxolan-3-yl]benzamide.
| Compound Name | 3-[1-(dimethylsulfamoyl)piperidin-4-yl]oxy-N-methyl-N-[(3R)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 42393600 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[1-(dimethylsulfamoyl)piperidin-4-yl]oxy-N-methyl-N-[(3R)-oxolan-3-yl]benzamide |
| SMILES | CN(C(=O)c1cccc(OC2CCN(S(=O)(=O)N(C)C)CC2)c1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C19H29N3O5S/c1-20(2)28(24,25)22-10-7-17(8-11-22)27-18-6-4-5-15(13-18)19(23)21(3)16-9-12-26-14-16/h4-6,13,16-17H,7-12,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | BAADOCZWVJUVOK-MRXNPFEDSA-N |
| XLogP | 1.20 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |