C11H6BrCl3N2O2S — CID 103775541
N-(6-bromo-3-pyridinyl)-2,4,6-trichlorobenzenesulfonamide (PubChem CID 103775541) has the molecular formula C11H6BrCl3N2O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-2,4,6-trichlorobenzenesulfonamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-2,4,6-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 103775541 |
| Molecular Formula | C11H6BrCl3N2O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 413.84 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-2,4,6-trichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)nc1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6BrCl3N2O2S/c12-10-2-1-7(5-16-10)17-20(18,19)11-8(14)3-6(13)4-9(11)15/h1-5,17H |
| InChIKey | KBINCVQNIMYXBM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|