C12H6BrCl4NO2S — CID 60640543
4-bromo-2,6-dichloro-N-(3,5-dichlorophenyl)benzenesulfonamide (PubChem CID 60640543) has the molecular formula C12H6BrCl4NO2S and a molecular weight of 449.97 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(3,5-dichlorophenyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(3,5-dichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60640543 |
| Molecular Formula | C12H6BrCl4NO2S |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 446.81 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(3,5-dichlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H6BrCl4NO2S/c13-6-1-10(16)12(11(17)2-6)21(19,20)18-9-4-7(14)3-8(15)5-9/h1-5,18H |
| InChIKey | KZAHRSFUBXQJIY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |