C12H8Cl2FNO3S — CID 103088374
2,4-dichloro-3-fluoro-N-(3-hydroxyphenyl)benzenesulfonamide (PubChem CID 103088374) has the molecular formula C12H8Cl2FNO3S and a molecular weight of 336.17 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-(3-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-(3-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088374 |
| Molecular Formula | C12H8Cl2FNO3S |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-(3-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(O)c1)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H8Cl2FNO3S/c13-9-4-5-10(11(14)12(9)15)20(18,19)16-7-2-1-3-8(17)6-7/h1-6,16-17H |
| InChIKey | ZTFGLMVOULCYMM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|