C11H7Cl2FN2O3S — CID 103088425
2,4-dichloro-3-fluoro-N-(3-hydroxy-2-pyridinyl)benzenesulfonamide (PubChem CID 103088425) has the molecular formula C11H7Cl2FN2O3S and a molecular weight of 337.16 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-(3-hydroxy-2-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-(3-hydroxy-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088425 |
| Molecular Formula | C11H7Cl2FN2O3S |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-(3-hydroxy-2-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncccc1O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H7Cl2FN2O3S/c12-6-3-4-8(9(13)10(6)14)20(18,19)16-11-7(17)2-1-5-15-11/h1-5,17H,(H,15,16) |
| InChIKey | CRBSTDMZWJKHFH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|