C8H8Cl3NO3S — CID 61059338
2,4,6-trichloro-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 61059338) has the molecular formula C8H8Cl3NO3S and a molecular weight of 304.58 g/mol. Its IUPAC name is 2,4,6-trichloro-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61059338 |
| Molecular Formula | C8H8Cl3NO3S |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 2,4,6-trichloro-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl3NO3S/c1-12(15-2)16(13,14)8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3 |
| InChIKey | HLJXZDHNUUXXIE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|