C13H13ClN2O4S — CID 104821363
N-(6-chloro-2-pyridinyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 104821363) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 104821363 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C13H13ClN2O4S/c1-19-9-6-7-11(10(8-9)20-2)21(17,18)16-13-5-3-4-12(14)15-13/h3-8H,1-2H3,(H,15,16) |
| InChIKey | QYFNEEHYUKZPJO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|