About 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide
3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide (PubChem CID 63590933) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 63590933 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide |
| SMILES | COc1cccc(NCCC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H17N3O2/c1-14(2)11(15)7-8-12-9-5-4-6-10(13-9)16-3/h4-6H,7-8H2,1-3H3,(H,12,13) |
| InChIKey | BDIGSJYHXAZCKP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide (CID 63590933) is 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide is COc1cccc(NCCC(=O)N(C)C)n1.
What is the InChIKey of 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide?
The InChIKey is BDIGSJYHXAZCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-14(2)11(15)7-8-12-9-5-4-6-10(13-9)16-3/h4-6H,7-8H2,1-3H3,(H,12,13).
What are the key properties of 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide?
3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide has a molecular weight of 223.28 g/mol, XLogP of 0.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-methoxy-2-pyridinyl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 63590933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).