C10H18N6O — CID 83118298
2-[(6-amino-2-propylpyrimidin-4-yl)amino]ethylurea (PubChem CID 83118298) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(6-amino-2-propylpyrimidin-4-yl)amino]ethylurea.
| Compound Name | 2-[(6-amino-2-propylpyrimidin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83118298 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[(6-amino-2-propylpyrimidin-4-yl)amino]ethylurea |
| SMILES | CCCc1nc(N)cc(NCCNC(N)=O)n1 |
| InChI | InChI=1S/C10H18N6O/c1-2-3-8-15-7(11)6-9(16-8)13-4-5-14-10(12)17/h6H,2-5H2,1H3,(H3,12,14,17)(H3,11,13,15,16) |
| InChIKey | MMKWBHLPSMEFLE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|