C14H22F3N3O — CID 102719358
1-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]pentan-2-ol (PubChem CID 102719358) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]pentan-2-ol.
| Compound Name | 1-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 102719358 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]pentan-2-ol |
| SMILES | CCCNc1cc(C(F)(F)F)cc(NCC(O)CCC)n1 |
| InChI | InChI=1S/C14H22F3N3O/c1-3-5-11(21)9-19-13-8-10(14(15,16)17)7-12(20-13)18-6-4-2/h7-8,11,21H,3-6,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | WNHXHBVYPFVGQC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |