C6H7ClN4S2 — CID 4275900
(6-chloro-2-methylsulfanylpyrimidin-4-yl)thiourea (PubChem CID 4275900) has the molecular formula C6H7ClN4S2 and a molecular weight of 234.74 g/mol. Its IUPAC name is (6-chloro-2-methylsulfanylpyrimidin-4-yl)thiourea.
| Compound Name | (6-chloro-2-methylsulfanylpyrimidin-4-yl)thiourea |
|---|---|
| PubChem CID | 4275900 |
| Molecular Formula | C6H7ClN4S2 |
| Molecular Weight | 234.74 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | (6-chloro-2-methylsulfanylpyrimidin-4-yl)thiourea |
| SMILES | CSc1nc(Cl)cc(NC(N)=S)n1 |
| InChI | InChI=1S/C6H7ClN4S2/c1-13-6-9-3(7)2-4(11-6)10-5(8)12/h2H,1H3,(H3,8,9,10,11,12) |
| InChIKey | OSGCBXNEKGWHSJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|