C9H14ClN3OS — CID 112724489
6-chloro-N-(1-methoxypropan-2-yl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 112724489) has the molecular formula C9H14ClN3OS and a molecular weight of 247.75 g/mol. Its IUPAC name is 6-chloro-N-(1-methoxypropan-2-yl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1-methoxypropan-2-yl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112724489 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 6-chloro-N-(1-methoxypropan-2-yl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | COCC(C)Nc1cc(Cl)nc(SC)n1 |
| InChI | InChI=1S/C9H14ClN3OS/c1-6(5-14-2)11-8-4-7(10)12-9(13-8)15-3/h4,6H,5H2,1-3H3,(H,11,12,13) |
| InChIKey | BESAKXZPEGAWQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |