C10H12ClN5S — CID 106214382
6-chloro-2-methylsulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 106214382) has the molecular formula C10H12ClN5S and a molecular weight of 269.76 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methylsulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106214382 |
| Molecular Formula | C10H12ClN5S |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NC(C)c2cn[nH]c2)n1 |
| InChI | InChI=1S/C10H12ClN5S/c1-6(7-4-12-13-5-7)14-9-3-8(11)15-10(16-9)17-2/h3-6H,1-2H3,(H,12,13)(H,14,15,16) |
| InChIKey | HJBJNHPXHAUAEF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |