C14H20ClN5 — CID 106214361
2-tert-butyl-6-chloro-5-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 106214361) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-5-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-chloro-5-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106214361 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-tert-butyl-6-chloro-5-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)(C)C)nc1NC(C)c1cn[nH]c1 |
| InChI | InChI=1S/C14H20ClN5/c1-8-11(15)19-13(14(3,4)5)20-12(8)18-9(2)10-6-16-17-7-10/h6-7,9H,1-5H3,(H,16,17)(H,18,19,20) |
| InChIKey | VIGZLQHKYJGIER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |