C11H15N5 — CID 106215673
3-methyl-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine (PubChem CID 106215673) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-methyl-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine.
| Compound Name | 3-methyl-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 106215673 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-methyl-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1NC(C)c1cn[nH]c1 |
| InChI | InChI=1S/C11H15N5/c1-7-3-10(12)6-13-11(7)16-8(2)9-4-14-15-5-9/h3-6,8H,12H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | MZJFSGWOJRDLQD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |