C13H18N4O2S — CID 106208351
5-amino-2,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 106208351) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-amino-2,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106208351 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-amino-2,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NC(C)c2cn[nH]c2)c1C |
| InChI | InChI=1S/C13H18N4O2S/c1-8-4-12(14)5-13(9(8)2)20(18,19)17-10(3)11-6-15-16-7-11/h4-7,10,17H,14H2,1-3H3,(H,15,16) |
| InChIKey | XXJGQDWZUPWJKE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|