C12H15ClN4O2S — CID 106217429
4-(aminomethyl)-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 106217429) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is 4-(aminomethyl)-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106217429 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-(aminomethyl)-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(CN)cc1Cl)c1cn[nH]c1 |
| InChI | InChI=1S/C12H15ClN4O2S/c1-8(10-6-15-16-7-10)17-20(18,19)12-3-2-9(5-14)4-11(12)13/h2-4,6-8,17H,5,14H2,1H3,(H,15,16) |
| InChIKey | HXZJFTFQWDGYSA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |