C10H10ClN5O2 — CID 114159167
6-chloro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridin-2-amine (PubChem CID 114159167) has the molecular formula C10H10ClN5O2 and a molecular weight of 267.68 g/mol. Its IUPAC name is 6-chloro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-chloro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114159167 |
| Molecular Formula | C10H10ClN5O2 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 6-chloro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridin-2-amine |
| SMILES | CC(Nc1cc([N+](=O)[O-])cc(Cl)n1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H10ClN5O2/c1-6(7-4-12-13-5-7)14-10-3-8(16(17)18)2-9(11)15-10/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | HEZLRKMWVRDLTM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|