C14H18N4O — CID 80779813
2-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]-1-phenylethanol (PubChem CID 80779813) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]-1-phenylethanol.
| Compound Name | 2-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 80779813 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]-1-phenylethanol |
| SMILES | CNc1cc(NCC(O)c2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C14H18N4O/c1-10-17-13(15-2)8-14(18-10)16-9-12(19)11-6-4-3-5-7-11/h3-8,12,19H,9H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | MSHITIMJUOZAEX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |