About (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol
(1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol (PubChem CID 51943081) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol |
| PubChem CID | 51943081 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol |
| SMILES | COc1ccccc1[C@@H](O)CNc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-8-15(18-11(2)17-10)16-9-13(19)12-6-4-5-7-14(12)20-3/h4-8,13,19H,9H2,1-3H3,(H,16,17,18)/t13-/m0/s1 |
| InChIKey | HRXZESLZNRHHAX-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol?
The IUPAC name of (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol (CID 51943081) is (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol.
What is the SMILES notation for (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol?
The canonical SMILES for (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol is COc1ccccc1[C@@H](O)CNc1cc(C)nc(C)n1.
What is the InChIKey of (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol?
The InChIKey is HRXZESLZNRHHAX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-10-8-15(18-11(2)17-10)16-9-13(19)12-6-4-5-7-14(12)20-3/h4-8,13,19H,9H2,1-3H3,(H,16,17,18)/t13-/m0/s1.
What are the key properties of (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol?
(1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol has a molecular weight of 273.34 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[(2,6-dimethylpyrimidin-4-yl)amino]-1-(2-methoxyphenyl)ethanol is sourced from PubChem (CID 51943081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).