C19H19ClN4O — CID 24824262
2-[[2-(3-chloroanilino)pyrimidin-4-yl]amino]-1-(4-methylphenyl)ethanol (PubChem CID 24824262) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-[[2-(3-chloroanilino)pyrimidin-4-yl]amino]-1-(4-methylphenyl)ethanol.
| Compound Name | 2-[[2-(3-chloroanilino)pyrimidin-4-yl]amino]-1-(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 24824262 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[[2-(3-chloroanilino)pyrimidin-4-yl]amino]-1-(4-methylphenyl)ethanol |
| SMILES | Cc1ccc(C(O)CNc2ccnc(Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H19ClN4O/c1-13-5-7-14(8-6-13)17(25)12-22-18-9-10-21-19(24-18)23-16-4-2-3-15(20)11-16/h2-11,17,25H,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | QVSTXROLKDLFON-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |