C20H22N4O4S — CID 24824538
1-(3-methoxyphenyl)-2-[[2-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]ethanol (PubChem CID 24824538) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[[2-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-[[2-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 24824538 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[[2-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]ethanol |
| SMILES | COc1cccc(C(O)CNc2ccnc(Nc3cccc(S(C)(=O)=O)c3)n2)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-28-16-7-3-5-14(11-16)18(25)13-22-19-9-10-21-20(24-19)23-15-6-4-8-17(12-15)29(2,26)27/h3-12,18,25H,13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | IJNGMMVGDLVDSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |