C15H13FN4O2 — CID 167870458
methyl 6-[(5-fluoro-1H-indol-3-yl)methylamino]pyridazine-3-carboxylate (PubChem CID 167870458) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is methyl 6-[(5-fluoro-1H-indol-3-yl)methylamino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(5-fluoro-1H-indol-3-yl)methylamino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 167870458 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 6-[(5-fluoro-1H-indol-3-yl)methylamino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCc2c[nH]c3ccc(F)cc23)nn1 |
| InChI | InChI=1S/C15H13FN4O2/c1-22-15(21)13-4-5-14(20-19-13)18-8-9-7-17-12-3-2-10(16)6-11(9)12/h2-7,17H,8H2,1H3,(H,18,20) |
| InChIKey | SSTPPROPMPVGKC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |