C14H22N4O2 — CID 60968158
methyl 6-[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]pyridazine-3-carboxylate (PubChem CID 60968158) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 6-[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60968158 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | methyl 6-[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCC(C)CN2CCCC2)nn1 |
| InChI | InChI=1S/C14H22N4O2/c1-11(10-18-7-3-4-8-18)9-15-13-6-5-12(16-17-13)14(19)20-2/h5-6,11H,3-4,7-10H2,1-2H3,(H,15,17) |
| InChIKey | YJKOESDHJIPZHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |