About methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate
methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate (PubChem CID 107164283) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate |
| PubChem CID | 107164283 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCC2(C)CCN(C)CC2)nn1 |
| InChI | InChI=1S/C14H22N4O2/c1-14(6-8-18(2)9-7-14)10-15-12-5-4-11(16-17-12)13(19)20-3/h4-5H,6-10H2,1-3H3,(H,15,17) |
| InChIKey | UQVYHUZBDYWSGY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate?
The IUPAC name of methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate (CID 107164283) is methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate.
What is the SMILES notation for methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate?
The canonical SMILES for methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate is COC(=O)c1ccc(NCC2(C)CCN(C)CC2)nn1.
What is the InChIKey of methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate?
The InChIKey is UQVYHUZBDYWSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c1-14(6-8-18(2)9-7-14)10-15-12-5-4-11(16-17-12)13(19)20-3/h4-5H,6-10H2,1-3H3,(H,15,17).
What are the key properties of methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate?
methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate has a molecular weight of 278.36 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(1,4-dimethylpiperidin-4-yl)methylamino]pyridazine-3-carboxylate is sourced from PubChem (CID 107164283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).