C17H17N3O3 — CID 109202435
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(prop-2-enylamino)pyridine-2-carboxamide (PubChem CID 109202435) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(prop-2-enylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(prop-2-enylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109202435 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(prop-2-enylamino)pyridine-2-carboxamide |
| SMILES | C=CCNc1ccnc(C(=O)Nc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H17N3O3/c1-2-6-18-12-5-7-19-14(10-12)17(21)20-13-3-4-15-16(11-13)23-9-8-22-15/h2-5,7,10-11H,1,6,8-9H2,(H,18,19)(H,20,21) |
| InChIKey | QOBQGQOHOLJWRQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|