C17H12BrFN4O — CID 109128469
N-(4-bromophenyl)-6-(4-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109128469) has the molecular formula C17H12BrFN4O and a molecular weight of 387.21 g/mol. Its IUPAC name is N-(4-bromophenyl)-6-(4-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-6-(4-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109128469 |
| Molecular Formula | C17H12BrFN4O |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | N-(4-bromophenyl)-6-(4-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccc(Nc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C17H12BrFN4O/c18-11-1-5-14(6-2-11)21-17(24)15-9-10-16(23-22-15)20-13-7-3-12(19)4-8-13/h1-10H,(H,20,23)(H,21,24) |
| InChIKey | QUGUTOVOGVGOFI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |