C17H16N4OS — CID 113046423
N-[6-(3,5-dimethylanilino)pyridazin-3-yl]thiophene-2-carboxamide (PubChem CID 113046423) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[6-(3,5-dimethylanilino)pyridazin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-(3,5-dimethylanilino)pyridazin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113046423 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[6-(3,5-dimethylanilino)pyridazin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2ccc(NC(=O)c3cccs3)nn2)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-11-8-12(2)10-13(9-11)18-15-5-6-16(21-20-15)19-17(22)14-4-3-7-23-14/h3-10H,1-2H3,(H,18,20)(H,19,21,22) |
| InChIKey | AQFDLKJKXZOUJU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |