C14H14N4O5 — CID 108733786
ethyl 4-carbamoyl-2-methyl-5-(pyrazine-2-carbonylamino)furan-3-carboxylate (PubChem CID 108733786) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is ethyl 4-carbamoyl-2-methyl-5-(pyrazine-2-carbonylamino)furan-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-2-methyl-5-(pyrazine-2-carbonylamino)furan-3-carboxylate |
|---|---|
| PubChem CID | 108733786 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | ethyl 4-carbamoyl-2-methyl-5-(pyrazine-2-carbonylamino)furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)c2cnccn2)c1C(N)=O |
| InChI | InChI=1S/C14H14N4O5/c1-3-22-14(21)9-7(2)23-13(10(9)11(15)19)18-12(20)8-6-16-4-5-17-8/h4-6H,3H2,1-2H3,(H2,15,19)(H,18,20) |
| InChIKey | SKHWPQNQBZOSLB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |