C14H16N4O4 — CID 108774168
ethyl 4-carbamoyl-2-methyl-5-[(6-methylpyrimidin-4-yl)amino]furan-3-carboxylate (PubChem CID 108774168) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is ethyl 4-carbamoyl-2-methyl-5-[(6-methylpyrimidin-4-yl)amino]furan-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-2-methyl-5-[(6-methylpyrimidin-4-yl)amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108774168 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 4-carbamoyl-2-methyl-5-[(6-methylpyrimidin-4-yl)amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(Nc2cc(C)ncn2)c1C(N)=O |
| InChI | InChI=1S/C14H16N4O4/c1-4-21-14(20)10-8(3)22-13(11(10)12(15)19)18-9-5-7(2)16-6-17-9/h5-6H,4H2,1-3H3,(H2,15,19)(H,16,17,18) |
| InChIKey | SAWXEMZNWNOYGI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |