C17H19N3O6 — CID 108776690
ethyl 6-[(4-acetyl-3-ethoxycarbonyl-5-methylfuran-2-yl)amino]pyridazine-3-carboxylate (PubChem CID 108776690) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is ethyl 6-[(4-acetyl-3-ethoxycarbonyl-5-methylfuran-2-yl)amino]pyridazine-3-carboxylate.
| Compound Name | ethyl 6-[(4-acetyl-3-ethoxycarbonyl-5-methylfuran-2-yl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 108776690 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | ethyl 6-[(4-acetyl-3-ethoxycarbonyl-5-methylfuran-2-yl)amino]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Nc2oc(C)c(C(C)=O)c2C(=O)OCC)nn1 |
| InChI | InChI=1S/C17H19N3O6/c1-5-24-16(22)11-7-8-12(20-19-11)18-15-14(17(23)25-6-2)13(9(3)21)10(4)26-15/h7-8H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | NFCPZBUKYRZDCG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |