About ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate
ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate (PubChem CID 108774402) has the molecular formula C24H18N4O3
and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate |
| PubChem CID | 108774402 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)nn1 |
| InChI | InChI=1S/C24H18N4O3/c1-2-30-24(29)19-13-14-20(28-27-19)26-23-18(15-25)21(16-9-5-3-6-10-16)22(31-23)17-11-7-4-8-12-17/h3-14H,2H2,1H3,(H,26,28) |
| InChIKey | UAGIQSPWTXPZLB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate?
The IUPAC name of ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate (CID 108774402) is ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate.
What is the SMILES notation for ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate?
The canonical SMILES for ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate is CCOC(=O)c1ccc(Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)nn1.
What is the InChIKey of ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate?
The InChIKey is UAGIQSPWTXPZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4O3/c1-2-30-24(29)19-13-14-20(28-27-19)26-23-18(15-25)21(16-9-5-3-6-10-16)22(31-23)17-11-7-4-8-12-17/h3-14H,2H2,1H3,(H,26,28).
What are the key properties of ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate?
ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate has a molecular weight of 410.43 g/mol, XLogP of 5.20, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(3-cyano-4,5-diphenylfuran-2-yl)amino]pyridazine-3-carboxylate is sourced from PubChem (CID 108774402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).