C21H18N2O — CID 889937
(E)-N-(6-methyl-2-pyridinyl)-2,3-diphenylprop-2-enamide (PubChem CID 889937) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is (E)-N-(6-methyl-2-pyridinyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(6-methyl-2-pyridinyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 889937 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (E)-N-(6-methyl-2-pyridinyl)-2,3-diphenylprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(=C/c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H18N2O/c1-16-9-8-14-20(22-16)23-21(24)19(18-12-6-3-7-13-18)15-17-10-4-2-5-11-17/h2-15H,1H3,(H,22,23,24)/b19-15+ |
| InChIKey | NOWPOURACYVDGY-XDJHFCHBSA-N |
| XLogP | 4.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|