C22H18N2O3 — CID 2190509
(Z)-N-(2-methyl-3-nitrophenyl)-2,3-diphenylprop-2-enamide (PubChem CID 2190509) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (Z)-N-(2-methyl-3-nitrophenyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-(2-methyl-3-nitrophenyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 2190509 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (Z)-N-(2-methyl-3-nitrophenyl)-2,3-diphenylprop-2-enamide |
| SMILES | Cc1c(NC(=O)/C(=C\c2ccccc2)c2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N2O3/c1-16-20(13-8-14-21(16)24(26)27)23-22(25)19(18-11-6-3-7-12-18)15-17-9-4-2-5-10-17/h2-15H,1H3,(H,23,25)/b19-15- |
| InChIKey | FGZKDAOOWUYGMU-CYVLTUHYSA-N |
| XLogP | 5.08 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|