C15H13N3O5 — CID 162326925
(E)-but-2-enedioic acid;N-pyrimidin-2-ylbenzamide (PubChem CID 162326925) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-pyrimidin-2-ylbenzamide.
| Compound Name | (E)-but-2-enedioic acid;N-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 162326925 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (E)-but-2-enedioic acid;N-pyrimidin-2-ylbenzamide |
| SMILES | O=C(Nc1ncccn1)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H9N3O.C4H4O4/c15-10(9-5-2-1-3-6-9)14-11-12-7-4-8-13-11;5-3(6)1-2-4(7)8/h1-8H,(H,12,13,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OKSYJUUUHJZMSY-WLHGVMLRSA-N |
| XLogP | 1.44 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|