C19H15N3OS — CID 146189979
2-cyano-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]acetamide (PubChem CID 146189979) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-cyano-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyano-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 146189979 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-cyano-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2sc(NC(=O)CC#N)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c1-13-7-9-15(10-8-13)18-17(14-5-3-2-4-6-14)22-19(24-18)21-16(23)11-12-20/h2-10H,11H2,1H3,(H,21,22,23) |
| InChIKey | DKGPKNJXSGPGSQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |