C26H21N3O3S — CID 146189984
2-cyano-3-(3,4-dihydroxyphenyl)-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]propanamide (PubChem CID 146189984) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dihydroxyphenyl)-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-cyano-3-(3,4-dihydroxyphenyl)-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 146189984 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-cyano-3-(3,4-dihydroxyphenyl)-N-[5-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(-c2sc(NC(=O)C(C#N)Cc3ccc(O)c(O)c3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3S/c1-16-7-10-19(11-8-16)24-23(18-5-3-2-4-6-18)28-26(33-24)29-25(32)20(15-27)13-17-9-12-21(30)22(31)14-17/h2-12,14,20,30-31H,13H2,1H3,(H,28,29,32) |
| InChIKey | KJTQBUINCNPOIV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|