C20H17N3O3S — CID 146190069
2-cyano-3-(3,4-dihydroxyphenyl)-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 146190069) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dihydroxyphenyl)-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-cyano-3-(3,4-dihydroxyphenyl)-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 146190069 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-cyano-3-(3,4-dihydroxyphenyl)-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccccc1-c1csc(NC(=O)C(C#N)Cc2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C20H17N3O3S/c1-12-4-2-3-5-15(12)16-11-27-20(22-16)23-19(26)14(10-21)8-13-6-7-17(24)18(25)9-13/h2-7,9,11,14,24-25H,8H2,1H3,(H,22,23,26) |
| InChIKey | LNVKRJICJPWURL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|