C22H16N6O6S — CID 108728877
N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108728877) has the molecular formula C22H16N6O6S and a molecular weight of 492.47 g/mol. Its IUPAC name is N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108728877 |
| Molecular Formula | C22H16N6O6S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cccc(-c2csc3nc(NC(=O)CCN4C(=O)c5cccc([N+](=O)[O-])c5C4=O)nn23)c1 |
| InChI | InChI=1S/C22H16N6O6S/c1-34-13-5-2-4-12(10-13)16-11-35-22-24-21(25-27(16)22)23-17(29)8-9-26-19(30)14-6-3-7-15(28(32)33)18(14)20(26)31/h2-7,10-11H,8-9H2,1H3,(H,23,25,29) |
| InChIKey | FAXIUANWDTYESR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|