C21H23N7O2S — CID 108810176
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide (PubChem CID 108810176) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108810176 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[6-(3-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
| SMILES | COc1cccc(-c2csc3nc(NC(=O)CCCNc4nc(C)cc(C)n4)nn23)c1 |
| InChI | InChI=1S/C21H23N7O2S/c1-13-10-14(2)24-19(23-13)22-9-5-8-18(29)25-20-26-21-28(27-20)17(12-31-21)15-6-4-7-16(11-15)30-3/h4,6-7,10-12H,5,8-9H2,1-3H3,(H,22,23,24)(H,25,27,29) |
| InChIKey | FGXWTUUGDFWTLK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|